C21H24N4O3 — CID 42157480
butyl 4-[(1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]benzoate (PubChem CID 42157480) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is butyl 4-[(1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 42157480 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | butyl 4-[(1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cnc3c(cnn3C(C)C)c2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-4-5-10-28-21(27)15-6-8-18(9-7-15)24-20(26)17-11-16-13-23-25(14(2)3)19(16)22-12-17/h6-9,11-14H,4-5,10H2,1-3H3,(H,24,26) |
| InChIKey | XORAIFPREXCHKT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|