C20H18N4O4S2 — CID 2158450
10-methyl-2-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 2158450) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 10-methyl-2-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | 10-methyl-2-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 2158450 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 10-methyl-2-oxo-N-[2-(4-sulfamoylphenyl)ethyl]-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | Cc1cccn2c(=O)c3cc(C(=O)NCCc4ccc(S(N)(=O)=O)cc4)sc3nc12 |
| InChI | InChI=1S/C20H18N4O4S2/c1-12-3-2-10-24-17(12)23-19-15(20(24)26)11-16(29-19)18(25)22-9-8-13-4-6-14(7-5-13)30(21,27)28/h2-7,10-11H,8-9H2,1H3,(H,22,25)(H2,21,27,28) |
| InChIKey | FPYIXMMAMSITNV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |