C16H13N3O3S — CID 67125591
methyl 4-methyl-3-(thieno[2,3-b]pyrazine-6-carbonylamino)benzoate (PubChem CID 67125591) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is methyl 4-methyl-3-(thieno[2,3-b]pyrazine-6-carbonylamino)benzoate.
| Compound Name | methyl 4-methyl-3-(thieno[2,3-b]pyrazine-6-carbonylamino)benzoate |
|---|---|
| PubChem CID | 67125591 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | methyl 4-methyl-3-(thieno[2,3-b]pyrazine-6-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)c2cc3nccnc3s2)c1 |
| InChI | InChI=1S/C16H13N3O3S/c1-9-3-4-10(16(21)22-2)7-11(9)19-14(20)13-8-12-15(23-13)18-6-5-17-12/h3-8H,1-2H3,(H,19,20) |
| InChIKey | CIQGSOHLUOLGFE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |