C35H37N3O5S4 — CID 101374627
N-(3,5-dinitrophenyl)-4-hexyl-5-[5-[5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carboxamide (PubChem CID 101374627) has the molecular formula C35H37N3O5S4 and a molecular weight of 707.97 g/mol. Its IUPAC name is N-(3,5-dinitrophenyl)-4-hexyl-5-[5-[5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carboxamide.
| Compound Name | N-(3,5-dinitrophenyl)-4-hexyl-5-[5-[5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 101374627 |
| Molecular Formula | C35H37N3O5S4 |
| Molecular Weight | 707.97 g/mol |
| Exact Mass | 707.16 |
| IUPAC Name | N-(3,5-dinitrophenyl)-4-hexyl-5-[5-[5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene-2-carboxamide |
| SMILES | CCCCCCc1ccsc1-c1ccc(-c2ccc(-c3sc(C(=O)Nc4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)cc3CCCCCC)s2)s1 |
| InChI | InChI=1S/C35H37N3O5S4/c1-3-5-7-9-11-23-17-18-44-33(23)30-15-13-28(45-30)29-14-16-31(46-29)34-24(12-10-8-6-4-2)19-32(47-34)35(39)36-25-20-26(37(40)41)22-27(21-25)38(42)43/h13-22H,3-12H2,1-2H3,(H,36,39) |
| InChIKey | MVZUBHIZPKYEJO-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.97 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|