C34H46O4 — CID 101375633
(E,2Z)-2-(2-methoxy-2-oxoethylidene)-14-[4-(4-pentylphenyl)phenyl]tetradec-3-enoic acid (PubChem CID 101375633) has the molecular formula C34H46O4 and a molecular weight of 518.74 g/mol. Its IUPAC name is (E,2Z)-2-(2-methoxy-2-oxoethylidene)-14-[4-(4-pentylphenyl)phenyl]tetradec-3-enoic acid.
| Compound Name | (E,2Z)-2-(2-methoxy-2-oxoethylidene)-14-[4-(4-pentylphenyl)phenyl]tetradec-3-enoic acid |
|---|---|
| PubChem CID | 101375633 |
| Molecular Formula | C34H46O4 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | (E,2Z)-2-(2-methoxy-2-oxoethylidene)-14-[4-(4-pentylphenyl)phenyl]tetradec-3-enoic acid |
| SMILES | CCCCCc1ccc(-c2ccc(CCCCCCCCCC/C=C/C(=C/C(=O)OC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H46O4/c1-3-4-13-16-28-19-23-30(24-20-28)31-25-21-29(22-26-31)17-14-11-9-7-5-6-8-10-12-15-18-32(34(36)37)27-33(35)38-2/h15,18-27H,3-14,16-17H2,1-2H3,(H,36,37)/b18-15+,32-27- |
| InChIKey | GBMFFSZESPGJCB-RTYGAEGISA-N |
| XLogP | 8.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|