C26H14F6N2S2 — CID 101376445
2,5-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]pyrazine (PubChem CID 101376445) has the molecular formula C26H14F6N2S2 and a molecular weight of 532.53 g/mol. Its IUPAC name is 2,5-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]pyrazine.
| Compound Name | 2,5-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]pyrazine |
|---|---|
| PubChem CID | 101376445 |
| Molecular Formula | C26H14F6N2S2 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 2,5-bis[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]pyrazine |
| SMILES | FC(F)(F)c1ccc(-c2ccc(-c3cnc(-c4ccc(-c5ccc(C(F)(F)F)cc5)s4)cn3)s2)cc1 |
| InChI | InChI=1S/C26H14F6N2S2/c27-25(28,29)17-5-1-15(2-6-17)21-9-11-23(35-21)19-13-34-20(14-33-19)24-12-10-22(36-24)16-3-7-18(8-4-16)26(30,31)32/h1-14H |
| InChIKey | HWDSOFLVFNATRI-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |