C27H40O7 — CID 101377902
[(3S,8S,9S,10S,11S,12R,13S,14S,17S)-17-acetyl-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 101377902) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is [(3S,8S,9S,10S,11S,12R,13S,14S,17S)-17-acetyl-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10S,11S,12R,13S,14S,17S)-17-acetyl-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 101377902 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [(3S,8S,9S,10S,11S,12R,13S,14S,17S)-17-acetyl-11,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@@H]3[C@@H]2[C@H](OC(C)=O)[C@H](OC(C)=O)[C@]2(C)[C@@H](C(C)=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C27H40O7/c1-14(28)21-9-10-22-20-8-7-18-13-19(32-15(2)29)11-12-26(18,5)23(20)24(33-16(3)30)25(27(21,22)6)34-17(4)31/h18-25H,7-13H2,1-6H3/t18?,19-,20-,21+,22-,23+,24-,25-,26-,27+/m0/s1 |
| InChIKey | JHZCNZUEHYYXMC-CJGBAEAYSA-N |
| XLogP | 4.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|