C24H36O5 — CID 123194995
(13,17-diacetyl-12-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 123194995) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (13,17-diacetyl-12-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (13,17-diacetyl-12-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 123194995 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (13,17-diacetyl-12-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C2CC(O)C2(C(C)=O)C(C(C)=O)CCC32)C1 |
| InChI | InChI=1S/C24H36O5/c1-13(25)19-7-8-20-18-6-5-16-11-17(29-15(3)27)9-10-23(16,4)21(18)12-22(28)24(19,20)14(2)26/h16-22,28H,5-12H2,1-4H3 |
| InChIKey | OHTNZLMYKYKCDZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |