C22H18ClF5N4O3 — CID 1013781
(5R,7S)-3-chloro-N-(2,4-difluorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1013781) has the molecular formula C22H18ClF5N4O3 and a molecular weight of 516.85 g/mol. Its IUPAC name is (5R,7S)-3-chloro-N-(2,4-difluorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7S)-3-chloro-N-(2,4-difluorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1013781 |
| Molecular Formula | C22H18ClF5N4O3 |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (5R,7S)-3-chloro-N-(2,4-difluorophenyl)-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)Nc4ccc(F)cc4F)c(Cl)c3N2)cc1OC |
| InChI | InChI=1S/C22H18ClF5N4O3/c1-34-15-6-3-10(7-16(15)35-2)14-9-17(22(26,27)28)32-20(29-14)18(23)19(31-32)21(33)30-13-5-4-11(24)8-12(13)25/h3-8,14,17,29H,9H2,1-2H3,(H,30,33)/t14-,17+/m1/s1 |
| InChIKey | DJEAAVQGOQPWLR-PBHICJAKSA-N |
| XLogP | 5.74 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |