C23H22ClF3N4O3 — CID 1127935
(5R,7R)-N-benzyl-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1127935) has the molecular formula C23H22ClF3N4O3 and a molecular weight of 494.90 g/mol. Its IUPAC name is (5R,7R)-N-benzyl-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-N-benzyl-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1127935 |
| Molecular Formula | C23H22ClF3N4O3 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (5R,7R)-N-benzyl-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1ccc([C@H]2C[C@H](C(F)(F)F)n3nc(C(=O)NCc4ccccc4)c(Cl)c3N2)cc1OC |
| InChI | InChI=1S/C23H22ClF3N4O3/c1-33-16-9-8-14(10-17(16)34-2)15-11-18(23(25,26)27)31-21(29-15)19(24)20(30-31)22(32)28-12-13-6-4-3-5-7-13/h3-10,15,18,29H,11-12H2,1-2H3,(H,28,32)/t15-,18-/m1/s1 |
| InChIKey | FYMJMZKYYHZENE-CRAIPNDOSA-N |
| XLogP | 5.14 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |