C33H33ClF3N5O3 — CID 136764281
(4-benzhydrylpiperazin-1-yl)-[(5S,7S)-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 136764281) has the molecular formula C33H33ClF3N5O3 and a molecular weight of 640.11 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[(5S,7S)-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[(5S,7S)-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 136764281 |
| Molecular Formula | C33H33ClF3N5O3 |
| Molecular Weight | 640.11 g/mol |
| Exact Mass | 639.22 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[(5S,7S)-3-chloro-5-(3,4-dimethoxyphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | COc1ccc([C@@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)N4CCN(C(c5ccccc5)c5ccccc5)CC4)c(Cl)c3N2)cc1OC |
| InChI | InChI=1S/C33H33ClF3N5O3/c1-44-25-14-13-23(19-26(25)45-2)24-20-27(33(35,36)37)42-31(38-24)28(34)29(39-42)32(43)41-17-15-40(16-18-41)30(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-14,19,24,27,30,38H,15-18,20H2,1-2H3/t24-,27-/m0/s1 |
| InChIKey | OXCBLIRISASFDZ-IGKIAQTJSA-N |
| XLogP | 6.76 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.11 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |