C20H17N7O3S — CID 10137836
N-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide (PubChem CID 10137836) has the molecular formula C20H17N7O3S and a molecular weight of 435.47 g/mol. Its IUPAC name is N-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 10137836 |
| Molecular Formula | C20H17N7O3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Sc2nc(Nc3cc(C)[nH]n3)c3ccc([N+](=O)[O-])cc3n2)cc1 |
| InChI | InChI=1S/C20H17N7O3S/c1-11-9-18(26-25-11)23-19-16-8-5-14(27(29)30)10-17(16)22-20(24-19)31-15-6-3-13(4-7-15)21-12(2)28/h3-10H,1-2H3,(H,21,28)(H2,22,23,24,25,26) |
| InChIKey | YBHYZASVIWTVAJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|