C20H17N7O3S — CID 18765141
N-[4-[4-[(2-methylpyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide (PubChem CID 18765141) has the molecular formula C20H17N7O3S and a molecular weight of 435.47 g/mol. Its IUPAC name is N-[4-[4-[(2-methylpyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[4-[(2-methylpyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 18765141 |
| Molecular Formula | C20H17N7O3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-[4-[4-[(2-methylpyrazol-3-yl)amino]-7-nitroquinazolin-2-yl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Sc2nc(Nc3ccnn3C)c3ccc([N+](=O)[O-])cc3n2)cc1 |
| InChI | InChI=1S/C20H17N7O3S/c1-12(28)22-13-3-6-15(7-4-13)31-20-23-17-11-14(27(29)30)5-8-16(17)19(25-20)24-18-9-10-21-26(18)2/h3-11H,1-2H3,(H,22,28)(H,23,24,25) |
| InChIKey | XDEDJZPWONOTJX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|