C15H24 — CID 101379953
(1S,2R,5R)-2-ethenyl-2,6,6-trimethyl-1-prop-1-en-2-ylbicyclo[3.2.0]heptane (PubChem CID 101379953) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is (1S,2R,5R)-2-ethenyl-2,6,6-trimethyl-1-prop-1-en-2-ylbicyclo[3.2.0]heptane.
| Compound Name | (1S,2R,5R)-2-ethenyl-2,6,6-trimethyl-1-prop-1-en-2-ylbicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 101379953 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (1S,2R,5R)-2-ethenyl-2,6,6-trimethyl-1-prop-1-en-2-ylbicyclo[3.2.0]heptane |
| SMILES | C=C[C@@]1(C)CC[C@@H]2C(C)(C)C[C@@]21C(=C)C |
| InChI | InChI=1S/C15H24/c1-7-14(6)9-8-12-13(4,5)10-15(12,14)11(2)3/h7,12H,1-2,8-10H2,3-6H3/t12-,14+,15-/m1/s1 |
| InChIKey | UAOBSVDFJSNTLJ-VHDGCEQUSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|