C17H28 — CID 177272316
(1S,2S,4R)-1-ethenyl-1,2,4-trimethyl-2,4-bis(prop-1-en-2-yl)cyclohexane (PubChem CID 177272316) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is (1S,2S,4R)-1-ethenyl-1,2,4-trimethyl-2,4-bis(prop-1-en-2-yl)cyclohexane.
| Compound Name | (1S,2S,4R)-1-ethenyl-1,2,4-trimethyl-2,4-bis(prop-1-en-2-yl)cyclohexane |
|---|---|
| PubChem CID | 177272316 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | (1S,2S,4R)-1-ethenyl-1,2,4-trimethyl-2,4-bis(prop-1-en-2-yl)cyclohexane |
| SMILES | C=C[C@]1(C)CC[C@@](C)(C(=C)C)C[C@@]1(C)C(=C)C |
| InChI | InChI=1S/C17H28/c1-9-16(7)11-10-15(6,13(2)3)12-17(16,8)14(4)5/h9H,1-2,4,10-12H2,3,5-8H3/t15-,16-,17+/m1/s1 |
| InChIKey | GULVQMSCNSQHJP-ZACQAIPSSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|