C16H28 — CID 153218597
1,1,2,2,3,4-hexamethyl-3,4-bis(prop-1-en-2-yl)cyclobutane (PubChem CID 153218597) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 1,1,2,2,3,4-hexamethyl-3,4-bis(prop-1-en-2-yl)cyclobutane.
| Compound Name | 1,1,2,2,3,4-hexamethyl-3,4-bis(prop-1-en-2-yl)cyclobutane |
|---|---|
| PubChem CID | 153218597 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 1,1,2,2,3,4-hexamethyl-3,4-bis(prop-1-en-2-yl)cyclobutane |
| SMILES | C=C(C)C1(C)C(C)(C)C(C)(C)C1(C)C(=C)C |
| InChI | InChI=1S/C16H28/c1-11(2)15(9)13(5,6)14(7,8)16(15,10)12(3)4/h1,3H2,2,4-10H3 |
| InChIKey | WNEUTIABGZDNHE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|