C10H15N — CID 166782106
1,5-dimethyl-5-prop-1-en-2-ylspiro[2.2]pent-1-en-2-amine (PubChem CID 166782106) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1,5-dimethyl-5-prop-1-en-2-ylspiro[2.2]pent-1-en-2-amine.
| Compound Name | 1,5-dimethyl-5-prop-1-en-2-ylspiro[2.2]pent-1-en-2-amine |
|---|---|
| PubChem CID | 166782106 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1,5-dimethyl-5-prop-1-en-2-ylspiro[2.2]pent-1-en-2-amine |
| SMILES | C=C(C)C1(C)CC12C(C)=C2N |
| InChI | InChI=1S/C10H15N/c1-6(2)9(4)5-10(9)7(3)8(10)11/h1,5,11H2,2-4H3 |
| InChIKey | SDGVBDCQNGYDRA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|