C13H20FN — CID 163774131
(2S,6R)-5-ethenyl-6-fluoro-2,6-dimethyl-2-prop-1-en-2-ylbicyclo[3.1.0]hexan-1-amine (PubChem CID 163774131) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is (2S,6R)-5-ethenyl-6-fluoro-2,6-dimethyl-2-prop-1-en-2-ylbicyclo[3.1.0]hexan-1-amine.
| Compound Name | (2S,6R)-5-ethenyl-6-fluoro-2,6-dimethyl-2-prop-1-en-2-ylbicyclo[3.1.0]hexan-1-amine |
|---|---|
| PubChem CID | 163774131 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | (2S,6R)-5-ethenyl-6-fluoro-2,6-dimethyl-2-prop-1-en-2-ylbicyclo[3.1.0]hexan-1-amine |
| SMILES | C=CC12CC[C@@](C)(C(=C)C)C1(N)[C@]2(C)F |
| InChI | InChI=1S/C13H20FN/c1-6-12-8-7-10(4,9(2)3)13(12,15)11(12,5)14/h6H,1-2,7-8,15H2,3-5H3/t10-,11+,12?,13?/m0/s1 |
| InChIKey | MIYGEMGDSUFDJN-ZFDZMSFRSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|