C53H34IO4PZn- — CID 101381042
CID 101381042 (PubChem CID 101381042) has the molecular formula C53H34IO4PZn- and a molecular weight of 958.12 g/mol.
| Compound Name | CID 101381042 |
|---|---|
| PubChem CID | 101381042 |
| Molecular Formula | C53H34IO4PZn- |
| Molecular Weight | 958.12 g/mol |
| Exact Mass | 956.05 |
| IUPAC Name | — |
| SMILES | O=P1([O-])Oc2c(-c3ccc(-c4ccc5ccccc5c4)cc3)cc3ccccc3c2-c2c(c(-c3ccc(-c4ccc5ccccc5c4)cc3)cc3ccccc23)O1.[CH2]I.[Zn] |
| InChI | InChI=1S/C52H33O4P.CH2I.Zn/c53-57(54)55-51-47(37-23-17-35(18-24-37)41-27-21-33-9-1-3-11-39(33)29-41)31-43-13-5-7-15-45(43)49(51)50-46-16-8-6-14-44(46)32-48(52(50)56-57)38-25-19-36(20-26-38)42-28-22-34-10-2-4-12-40(34)30-42;1-2;/h1-32H,(H,53,54);1H2;/p-1 |
| InChIKey | DBAKLTGLJRKCLN-UHFFFAOYSA-M |
| XLogP | 15.08 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.12 |
| LogP ≤ 5 | 15.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|