C22H15N3O2 — CID 101381338
2-amino-3-[[phenyl(pyridin-2-yl)methylidene]amino]naphthalene-1,4-dione (PubChem CID 101381338) has the molecular formula C22H15N3O2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-amino-3-[[phenyl(pyridin-2-yl)methylidene]amino]naphthalene-1,4-dione.
| Compound Name | 2-amino-3-[[phenyl(pyridin-2-yl)methylidene]amino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 101381338 |
| Molecular Formula | C22H15N3O2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-amino-3-[[phenyl(pyridin-2-yl)methylidene]amino]naphthalene-1,4-dione |
| SMILES | NC1=C(/N=C(\c2ccccc2)c2ccccn2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H15N3O2/c23-18-20(22(27)16-11-5-4-10-15(16)21(18)26)25-19(14-8-2-1-3-9-14)17-12-6-7-13-24-17/h1-13H,23H2/b25-19+ |
| InChIKey | LBOLOIQALNTFRY-NCELDCMTSA-N |
| XLogP | 3.17 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|