C18H33N3O3 — CID 101381391
tert-butyl (3S,9aS)-3-ethyl-8-(2-methylpropyl)-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 101381391) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is tert-butyl (3S,9aS)-3-ethyl-8-(2-methylpropyl)-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (3S,9aS)-3-ethyl-8-(2-methylpropyl)-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 101381391 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | tert-butyl (3S,9aS)-3-ethyl-8-(2-methylpropyl)-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC[C@H]1CN2CC(=O)N(CC(C)C)C[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33N3O3/c1-7-14-9-19-12-16(22)20(8-13(2)3)10-15(19)11-21(14)17(23)24-18(4,5)6/h13-15H,7-12H2,1-6H3/t14-,15-/m0/s1 |
| InChIKey | UFOBLZASTMCTIP-GJZGRUSLSA-N |
| XLogP | 2.18 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |