C20H38N4O3 — CID 101381393
tert-butyl (3S,9aS)-8-[2-(diethylamino)ethyl]-3-ethyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 101381393) has the molecular formula C20H38N4O3 and a molecular weight of 382.55 g/mol. Its IUPAC name is tert-butyl (3S,9aS)-8-[2-(diethylamino)ethyl]-3-ethyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl (3S,9aS)-8-[2-(diethylamino)ethyl]-3-ethyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 101381393 |
| Molecular Formula | C20H38N4O3 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | tert-butyl (3S,9aS)-8-[2-(diethylamino)ethyl]-3-ethyl-7-oxo-1,3,4,6,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC[C@H]1CN2CC(=O)N(CCN(CC)CC)C[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H38N4O3/c1-7-16-12-23-15-18(25)22(11-10-21(8-2)9-3)13-17(23)14-24(16)19(26)27-20(4,5)6/h16-17H,7-15H2,1-6H3/t16-,17-/m0/s1 |
| InChIKey | VAMDBEQZBPYZTQ-IRXDYDNUSA-N |
| XLogP | 1.87 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |