C43H42P2 — CID 101382224
[(1R,3R)-3-bis(4-methylphenyl)phosphanyl-1,3-diphenylpropyl]-bis(4-methylphenyl)phosphane (PubChem CID 101382224) has the molecular formula C43H42P2 and a molecular weight of 620.76 g/mol. Its IUPAC name is [(1R,3R)-3-bis(4-methylphenyl)phosphanyl-1,3-diphenylpropyl]-bis(4-methylphenyl)phosphane.
| Compound Name | [(1R,3R)-3-bis(4-methylphenyl)phosphanyl-1,3-diphenylpropyl]-bis(4-methylphenyl)phosphane |
|---|---|
| PubChem CID | 101382224 |
| Molecular Formula | C43H42P2 |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | [(1R,3R)-3-bis(4-methylphenyl)phosphanyl-1,3-diphenylpropyl]-bis(4-methylphenyl)phosphane |
| SMILES | Cc1ccc(P(c2ccc(C)cc2)[C@H](C[C@H](c2ccccc2)P(c2ccc(C)cc2)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H42P2/c1-32-15-23-38(24-16-32)44(39-25-17-33(2)18-26-39)42(36-11-7-5-8-12-36)31-43(37-13-9-6-10-14-37)45(40-27-19-34(3)20-28-40)41-29-21-35(4)22-30-41/h5-30,42-43H,31H2,1-4H3/t42-,43-/m1/s1 |
| InChIKey | GFGZHQCWZWATGF-OCQXTOTRSA-N |
| XLogP | 10.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|