C13H16O3S — CID 101382556
(3S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]thian-4-one (PubChem CID 101382556) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is (3S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]thian-4-one.
| Compound Name | (3S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]thian-4-one |
|---|---|
| PubChem CID | 101382556 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (3S)-3-[(R)-hydroxy-(4-methoxyphenyl)methyl]thian-4-one |
| SMILES | COc1ccc([C@H](O)[C@@H]2CSCCC2=O)cc1 |
| InChI | InChI=1S/C13H16O3S/c1-16-10-4-2-9(3-5-10)13(15)11-8-17-7-6-12(11)14/h2-5,11,13,15H,6-8H2,1H3/t11-,13+/m1/s1 |
| InChIKey | KIIHMADACKHGHD-YPMHNXCESA-N |
| XLogP | 2.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |