C14H24 — CID 101382621
(4R,6S)-6-deuterio-1-methyl-6-(2-methylpropyl)-4-prop-1-en-2-ylcyclohexene (PubChem CID 101382621) has the molecular formula C14H24 and a molecular weight of 193.35 g/mol. Its IUPAC name is (4R,6S)-6-deuterio-1-methyl-6-(2-methylpropyl)-4-prop-1-en-2-ylcyclohexene.
| Compound Name | (4R,6S)-6-deuterio-1-methyl-6-(2-methylpropyl)-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 101382621 |
| Molecular Formula | C14H24 |
| Molecular Weight | 193.35 g/mol |
| Exact Mass | 193.19 |
| IUPAC Name | (4R,6S)-6-deuterio-1-methyl-6-(2-methylpropyl)-4-prop-1-en-2-ylcyclohexene |
| SMILES | [2H][C@]1(CC(C)C)C[C@H](C(=C)C)CC=C1C |
| InChI | InChI=1S/C14H24/c1-10(2)8-14-9-13(11(3)4)7-6-12(14)5/h6,10,13-14H,3,7-9H2,1-2,4-5H3/t13-,14+/m1/s1/i14D |
| InChIKey | CJQRNGPBIAEXMG-OSBXQCMISA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|