C14H21N — CID 123301417
(4R)-6-(2-isocyanopropan-2-yl)-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 123301417) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (4R)-6-(2-isocyanopropan-2-yl)-1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | (4R)-6-(2-isocyanopropan-2-yl)-1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 123301417 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (4R)-6-(2-isocyanopropan-2-yl)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | [C-]#[N+]C(C)(C)C1C[C@H](C(=C)C)CC=C1C |
| InChI | InChI=1S/C14H21N/c1-10(2)12-8-7-11(3)13(9-12)14(4,5)15-6/h7,12-13H,1,8-9H2,2-5H3/t12-,13?/m1/s1 |
| InChIKey | UXCHEDXCUPWXGI-PZORYLMUSA-N |
| XLogP | 4.23 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|