C22H29N3O6 — CID 101384260
tert-butyl 4-[2-[2-(2-ethoxy-2-oxoacetyl)hydrazinyl]-2-oxo-1-phenylethylidene]piperidine-1-carboxylate (PubChem CID 101384260) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-(2-ethoxy-2-oxoacetyl)hydrazinyl]-2-oxo-1-phenylethylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[2-(2-ethoxy-2-oxoacetyl)hydrazinyl]-2-oxo-1-phenylethylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101384260 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | tert-butyl 4-[2-[2-(2-ethoxy-2-oxoacetyl)hydrazinyl]-2-oxo-1-phenylethylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C(=O)NNC(=O)C(=C1CCN(C(=O)OC(C)(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O6/c1-5-30-20(28)19(27)24-23-18(26)17(15-9-7-6-8-10-15)16-11-13-25(14-12-16)21(29)31-22(2,3)4/h6-10H,5,11-14H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | ZHLGTEIHLNDPCH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|