C13H18N2S — CID 101384623
(2S)-N-[(1S)-1-phenylethyl]pyrrolidine-2-carbothioamide (PubChem CID 101384623) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-phenylethyl]pyrrolidine-2-carbothioamide.
| Compound Name | (2S)-N-[(1S)-1-phenylethyl]pyrrolidine-2-carbothioamide |
|---|---|
| PubChem CID | 101384623 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2S)-N-[(1S)-1-phenylethyl]pyrrolidine-2-carbothioamide |
| SMILES | C[C@H](NC(=S)[C@@H]1CCCN1)c1ccccc1 |
| InChI | InChI=1S/C13H18N2S/c1-10(11-6-3-2-4-7-11)15-13(16)12-8-5-9-14-12/h2-4,6-7,10,12,14H,5,8-9H2,1H3,(H,15,16)/t10-,12-/m0/s1 |
| InChIKey | HAZMYUCALIRQSV-JQWIXIFHSA-N |
| XLogP | 2.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|