C14H19N — CID 101384665
(1S,2S)-2,6-dimethyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 101384665) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (1S,2S)-2,6-dimethyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S,2S)-2,6-dimethyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 101384665 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (1S,2S)-2,6-dimethyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C=CCN[C@@H]1c2cc(C)ccc2C[C@@H]1C |
| InChI | InChI=1S/C14H19N/c1-4-7-15-14-11(3)9-12-6-5-10(2)8-13(12)14/h4-6,8,11,14-15H,1,7,9H2,2-3H3/t11-,14-/m0/s1 |
| InChIKey | CEULXQBXNUAMGR-FZMZJTMJSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|