C13H18FN — CID 173049230
(1R,2S)-N-(1-fluoroethyl)-2,6-dimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 173049230) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is (1R,2S)-N-(1-fluoroethyl)-2,6-dimethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1R,2S)-N-(1-fluoroethyl)-2,6-dimethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 173049230 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (1R,2S)-N-(1-fluoroethyl)-2,6-dimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1ccc2c(c1)[C@H](NC(C)F)[C@@H](C)C2 |
| InChI | InChI=1S/C13H18FN/c1-8-4-5-11-7-9(2)13(12(11)6-8)15-10(3)14/h4-6,9-10,13,15H,7H2,1-3H3/t9-,10?,13+/m0/s1 |
| InChIKey | RUZXKYXXRMHEAY-BOURZNODSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|