C23H23FN4O — CID 129283780
N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-5-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]pyrimidin-2-amine (PubChem CID 129283780) has the molecular formula C23H23FN4O and a molecular weight of 390.46 g/mol. Its IUPAC name is N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-5-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]pyrimidin-2-amine.
| Compound Name | N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-5-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 129283780 |
| Molecular Formula | C23H23FN4O |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-5-[(E)-N-(4-fluorophenoxy)-C-methylcarbonimidoyl]pyrimidin-2-amine |
| SMILES | C/C(=N\Oc1ccc(F)cc1)c1cnc(N[C@H]2c3cc(C)ccc3C[C@@H]2C)nc1 |
| InChI | InChI=1S/C23H23FN4O/c1-14-4-5-17-11-15(2)22(21(17)10-14)27-23-25-12-18(13-26-23)16(3)28-29-20-8-6-19(24)7-9-20/h4-10,12-13,15,22H,11H2,1-3H3,(H,25,26,27)/b28-16+/t15-,22+/m0/s1 |
| InChIKey | INMCEIZZTVDFGC-WKLZMWQBSA-N |
| XLogP | 5.07 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|