C13H19N — CID 83907256
N,2,7-trimethyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 83907256) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N,2,7-trimethyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N,2,7-trimethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 83907256 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N,2,7-trimethyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CNC1c2cc(C)ccc2CCC1C |
| InChI | InChI=1S/C13H19N/c1-9-4-6-11-7-5-10(2)13(14-3)12(11)8-9/h4,6,8,10,13-14H,5,7H2,1-3H3 |
| InChIKey | JYKWOAGNROURIL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |