C20H26N4O — CID 129283763
(NE)-N-[1-[2-[[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]amino]-4-ethylpyrimidin-5-yl]propylidene]hydroxylamine (PubChem CID 129283763) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is (NE)-N-[1-[2-[[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]amino]-4-ethylpyrimidin-5-yl]propylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[2-[[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]amino]-4-ethylpyrimidin-5-yl]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 129283763 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (NE)-N-[1-[2-[[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]amino]-4-ethylpyrimidin-5-yl]propylidene]hydroxylamine |
| SMILES | CC/C(=N\O)c1cnc(N[C@H]2c3cc(C)ccc3C[C@@H]2C)nc1CC |
| InChI | InChI=1S/C20H26N4O/c1-5-17-16(18(6-2)24-25)11-21-20(22-17)23-19-13(4)10-14-8-7-12(3)9-15(14)19/h7-9,11,13,19,25H,5-6,10H2,1-4H3,(H,21,22,23)/b24-18+/t13-,19+/m0/s1 |
| InChIKey | MOEUXEYXUSKHIY-LMGPZKDASA-N |
| XLogP | 4.28 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|