C21H26N2O2S2 — CID 101384725
(2S)-N-methyl-3-phenyl-2-[[(2R)-3-phenyl-2-(2-sulfanylethylsulfanyl)propanoyl]amino]propanamide (PubChem CID 101384725) has the molecular formula C21H26N2O2S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is (2S)-N-methyl-3-phenyl-2-[[(2R)-3-phenyl-2-(2-sulfanylethylsulfanyl)propanoyl]amino]propanamide.
| Compound Name | (2S)-N-methyl-3-phenyl-2-[[(2R)-3-phenyl-2-(2-sulfanylethylsulfanyl)propanoyl]amino]propanamide |
|---|---|
| PubChem CID | 101384725 |
| Molecular Formula | C21H26N2O2S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (2S)-N-methyl-3-phenyl-2-[[(2R)-3-phenyl-2-(2-sulfanylethylsulfanyl)propanoyl]amino]propanamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)SCCS |
| InChI | InChI=1S/C21H26N2O2S2/c1-22-20(24)18(14-16-8-4-2-5-9-16)23-21(25)19(27-13-12-26)15-17-10-6-3-7-11-17/h2-11,18-19,26H,12-15H2,1H3,(H,22,24)(H,23,25)/t18-,19+/m0/s1 |
| InChIKey | KKYMDHXAHDVBMY-RBUKOAKNSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|