C15H18O5 — CID 101384764
methyl (1S,4S,8R,12S)-1-methoxy-4-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate (PubChem CID 101384764) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (1S,4S,8R,12S)-1-methoxy-4-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate.
| Compound Name | methyl (1S,4S,8R,12S)-1-methoxy-4-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate |
|---|---|
| PubChem CID | 101384764 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl (1S,4S,8R,12S)-1-methoxy-4-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC(=O)[C@@]3(OC)OC[C@@](C)(C=CC1)[C@H]32 |
| InChI | InChI=1S/C15H18O5/c1-13-6-4-7-14(12(17)18-2)8-5-10(16)15(19-3,11(13)14)20-9-13/h4-6,8,11H,7,9H2,1-3H3/t11-,13+,14+,15+/m0/s1 |
| InChIKey | PQEGKLKROCBHQE-ZGKBOVNRSA-N |
| XLogP | 1.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|