C14H16O4S — CID 10684153
S-methyl (1R,4R,8S,12R)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate (PubChem CID 10684153) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is S-methyl (1R,4R,8S,12R)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate.
| Compound Name | S-methyl (1R,4R,8S,12R)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate |
|---|---|
| PubChem CID | 10684153 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | S-methyl (1R,4R,8S,12R)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carbothioate |
| SMILES | CO[C@]12OC[C@@H]3C=CC[C@](C(=O)SC)(C=CC1=O)[C@@H]32 |
| InChI | InChI=1S/C14H16O4S/c1-17-14-10(15)5-7-13(12(16)19-2)6-3-4-9(8-18-14)11(13)14/h3-5,7,9,11H,6,8H2,1-2H3/t9-,11+,13-,14-/m0/s1 |
| InChIKey | IFYCHTGKFYCJIQ-HYKPAMGXSA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|