C15H18O5 — CID 101384762
methyl (1S,4S,7R,8S,12S)-1-methoxy-7-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate (PubChem CID 101384762) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl (1S,4S,7R,8S,12S)-1-methoxy-7-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate.
| Compound Name | methyl (1S,4S,7R,8S,12S)-1-methoxy-7-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate |
|---|---|
| PubChem CID | 101384762 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl (1S,4S,7R,8S,12S)-1-methoxy-7-methyl-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-8-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC(=O)[C@@]3(OC)OC[C@@H](C=C[C@H]1C)[C@H]32 |
| InChI | InChI=1S/C15H18O5/c1-9-4-5-10-8-20-15(19-3)11(16)6-7-14(9,12(10)15)13(17)18-2/h4-7,9-10,12H,8H2,1-3H3/t9-,10-,12+,14+,15-/m1/s1 |
| InChIKey | JFXVNFGWHDUVMR-IQCLJPLKSA-N |
| XLogP | 1.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|