C21H28O7 — CID 11509398
ethyl (1R,4R,7S,8S,12R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-7-carboxylate (PubChem CID 11509398) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is ethyl (1R,4R,7S,8S,12R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-7-carboxylate.
| Compound Name | ethyl (1R,4R,7S,8S,12R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-7-carboxylate |
|---|---|
| PubChem CID | 11509398 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl (1R,4R,7S,8S,12R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-1-methoxy-11-oxo-2-oxatricyclo[6.3.1.04,12]dodeca-5,9-diene-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1C=C[C@H]2CO[C@@]3(OC)C(=O)C=C[C@]1(C1OCC(C)(C)CO1)[C@@H]23 |
| InChI | InChI=1S/C21H28O7/c1-5-25-17(23)14-7-6-13-10-28-21(24-4)15(22)8-9-20(14,16(13)21)18-26-11-19(2,3)12-27-18/h6-9,13-14,16,18H,5,10-12H2,1-4H3/t13-,14+,16+,20+,21-/m0/s1 |
| InChIKey | KDFWJLPELRNAPK-JPBUZNBGSA-N |
| XLogP | 1.87 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|