C20H26O5 — CID 71747582
(3S,3aS,6aS,10aR)-7,7-dimethyl-3-(oxan-2-yloxy)-1-oxo-3a,6,6a,8-tetrahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde (PubChem CID 71747582) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (3S,3aS,6aS,10aR)-7,7-dimethyl-3-(oxan-2-yloxy)-1-oxo-3a,6,6a,8-tetrahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde.
| Compound Name | (3S,3aS,6aS,10aR)-7,7-dimethyl-3-(oxan-2-yloxy)-1-oxo-3a,6,6a,8-tetrahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 71747582 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (3S,3aS,6aS,10aR)-7,7-dimethyl-3-(oxan-2-yloxy)-1-oxo-3a,6,6a,8-tetrahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde |
| SMILES | CC1(C)CC=C[C@]23C(=O)O[C@H](OC4CCCCO4)[C@H]2C(C=O)=CC[C@@H]13 |
| InChI | InChI=1S/C20H26O5/c1-19(2)9-5-10-20-14(19)8-7-13(12-21)16(20)17(25-18(20)22)24-15-6-3-4-11-23-15/h5,7,10,12,14-17H,3-4,6,8-9,11H2,1-2H3/t14-,15?,16+,17-,20+/m0/s1 |
| InChIKey | RXXSXAAKIAVPMH-NPEMIBDPSA-N |
| XLogP | 3.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|