C20H28O4 — CID 163045430
(1S,4R,9R,12R)-9-methyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-ene-3,10-dione (PubChem CID 163045430) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,4R,9R,12R)-9-methyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-ene-3,10-dione.
| Compound Name | (1S,4R,9R,12R)-9-methyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-ene-3,10-dione |
|---|---|
| PubChem CID | 163045430 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (1S,4R,9R,12R)-9-methyl-7-[(1S)-1,3,3-trimethylcyclohexyl]-2,11-dioxatricyclo[6.3.1.04,12]dodec-7-ene-3,10-dione |
| SMILES | C[C@H]1C(=O)O[C@@H]2OC(=O)[C@@H]3CCC([C@@]4(C)CCCC(C)(C)C4)=C1[C@H]23 |
| InChI | InChI=1S/C20H28O4/c1-11-14-13(20(4)9-5-8-19(2,3)10-20)7-6-12-15(14)18(23-16(11)21)24-17(12)22/h11-12,15,18H,5-10H2,1-4H3/t11-,12-,15-,18-,20+/m1/s1 |
| InChIKey | CITWWGQNJPHWFE-PBVDNIBUSA-N |
| XLogP | 3.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|