C21H30O4 — CID 162893052
[(1R,3aS,7Z,7aS)-7-ethylidene-3-oxo-6-[(1R)-1,3,3-trimethylcyclohexyl]-1,3a,4,7a-tetrahydro-2-benzofuran-1-yl] acetate (PubChem CID 162893052) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(1R,3aS,7Z,7aS)-7-ethylidene-3-oxo-6-[(1R)-1,3,3-trimethylcyclohexyl]-1,3a,4,7a-tetrahydro-2-benzofuran-1-yl] acetate.
| Compound Name | [(1R,3aS,7Z,7aS)-7-ethylidene-3-oxo-6-[(1R)-1,3,3-trimethylcyclohexyl]-1,3a,4,7a-tetrahydro-2-benzofuran-1-yl] acetate |
|---|---|
| PubChem CID | 162893052 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [(1R,3aS,7Z,7aS)-7-ethylidene-3-oxo-6-[(1R)-1,3,3-trimethylcyclohexyl]-1,3a,4,7a-tetrahydro-2-benzofuran-1-yl] acetate |
| SMILES | C/C=C1\C([C@]2(C)CCCC(C)(C)C2)=CC[C@@H]2C(=O)O[C@@H](OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C21H30O4/c1-6-14-16(21(5)11-7-10-20(3,4)12-21)9-8-15-17(14)19(24-13(2)22)25-18(15)23/h6,9,15,17,19H,7-8,10-12H2,1-5H3/b14-6+/t15-,17+,19+,21+/m0/s1 |
| InChIKey | YXPFTOMEKAXZPB-CTJVAFLISA-N |
| XLogP | 4.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |