C19H24O4 — CID 163047012
methyl 2-[(3aS,7S,9aR,9bR)-7-ethenyl-7,9b-dimethyl-3-oxo-3a,8,9,9a-tetrahydro-1H-benzo[e][2]benzofuran-5-yl]acetate (PubChem CID 163047012) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 2-[(3aS,7S,9aR,9bR)-7-ethenyl-7,9b-dimethyl-3-oxo-3a,8,9,9a-tetrahydro-1H-benzo[e][2]benzofuran-5-yl]acetate.
| Compound Name | methyl 2-[(3aS,7S,9aR,9bR)-7-ethenyl-7,9b-dimethyl-3-oxo-3a,8,9,9a-tetrahydro-1H-benzo[e][2]benzofuran-5-yl]acetate |
|---|---|
| PubChem CID | 163047012 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | methyl 2-[(3aS,7S,9aR,9bR)-7-ethenyl-7,9b-dimethyl-3-oxo-3a,8,9,9a-tetrahydro-1H-benzo[e][2]benzofuran-5-yl]acetate |
| SMILES | C=C[C@@]1(C)C=C2C(CC(=O)OC)=C[C@@H]3C(=O)OC[C@]3(C)[C@@H]2CC1 |
| InChI | InChI=1S/C19H24O4/c1-5-18(2)7-6-14-13(10-18)12(9-16(20)22-4)8-15-17(21)23-11-19(14,15)3/h5,8,10,14-15H,1,6-7,9,11H2,2-4H3/t14-,15-,18-,19-/m1/s1 |
| InChIKey | RGAWDQLBIFAKJG-OHDICMOHSA-N |
| XLogP | 3.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|