C15H20O2 — CID 57408403
(3R,7S,8R,8aS)-3,7-dimethylspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-one (PubChem CID 57408403) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (3R,7S,8R,8aS)-3,7-dimethylspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-one.
| Compound Name | (3R,7S,8R,8aS)-3,7-dimethylspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 57408403 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3R,7S,8R,8aS)-3,7-dimethylspiro[2,3,7,8a-tetrahydro-1H-naphthalene-8,5'-oxolane]-2'-one |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@]3(CCC(=O)O3)[C@H]2CC1 |
| InChI | InChI=1S/C15H20O2/c1-10-3-6-13-12(9-10)5-4-11(2)15(13)8-7-14(16)17-15/h4-5,9-11,13H,3,6-8H2,1-2H3/t10-,11+,13+,15-/m1/s1 |
| InChIKey | XIZPBKMZTBITPA-REJLFOLJSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |