C14H19FO2 — CID 59975396
(1R,3aR,5S,8aS,9S,9aS)-5-fluoro-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one (PubChem CID 59975396) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is (1R,3aR,5S,8aS,9S,9aS)-5-fluoro-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one.
| Compound Name | (1R,3aR,5S,8aS,9S,9aS)-5-fluoro-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 59975396 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (1R,3aR,5S,8aS,9S,9aS)-5-fluoro-1,9-dimethyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-3-one |
| SMILES | C[C@@H]1[C@@H]2[C@@H](C)OC(=O)[C@@H]2C=C2[C@H]1CCC[C@@H]2F |
| InChI | InChI=1S/C14H19FO2/c1-7-9-4-3-5-12(15)10(9)6-11-13(7)8(2)17-14(11)16/h6-9,11-13H,3-5H2,1-2H3/t7-,8+,9-,11+,12-,13+/m0/s1 |
| InChIKey | AXYSEMJTAJEFFK-IGOYIBQOSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|