C21H34O4 — CID 10383259
(2R)-2-[(3R,3aR,7aR)-3-methoxy-5-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-4-yl]propanoic acid (PubChem CID 10383259) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2R)-2-[(3R,3aR,7aR)-3-methoxy-5-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-4-yl]propanoic acid.
| Compound Name | (2R)-2-[(3R,3aR,7aR)-3-methoxy-5-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-4-yl]propanoic acid |
|---|---|
| PubChem CID | 10383259 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2R)-2-[(3R,3aR,7aR)-3-methoxy-5-[(1S)-1,3,3-trimethylcyclohexyl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-4-yl]propanoic acid |
| SMILES | CO[C@@H]1OC[C@@H]2CCC([C@@]3(C)CCCC(C)(C)C3)=C([C@@H](C)C(=O)O)[C@@H]21 |
| InChI | InChI=1S/C21H34O4/c1-13(18(22)23)16-15(21(4)10-6-9-20(2,3)12-21)8-7-14-11-25-19(24-5)17(14)16/h13-14,17,19H,6-12H2,1-5H3,(H,22,23)/t13-,14+,17-,19-,21+/m1/s1 |
| InChIKey | ZACQAWRFBSMZEU-WLAJYOQSSA-N |
| XLogP | 4.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|