C21H34O4 — CID 163005660
(3S)-5-[(3S,6aR,7S,8R,10aS)-3-methoxy-7,8-dimethyl-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-7-yl]-3-methylpentanoic acid (PubChem CID 163005660) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (3S)-5-[(3S,6aR,7S,8R,10aS)-3-methoxy-7,8-dimethyl-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-7-yl]-3-methylpentanoic acid.
| Compound Name | (3S)-5-[(3S,6aR,7S,8R,10aS)-3-methoxy-7,8-dimethyl-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-7-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 163005660 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (3S)-5-[(3S,6aR,7S,8R,10aS)-3-methoxy-7,8-dimethyl-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-7-yl]-3-methylpentanoic acid |
| SMILES | CO[C@H]1OC[C@@]23CC[C@@H](C)[C@](C)(CC[C@H](C)CC(=O)O)[C@H]2CCC=C13 |
| InChI | InChI=1S/C21H34O4/c1-14(12-18(22)23)8-10-20(3)15(2)9-11-21-13-25-19(24-4)16(21)6-5-7-17(20)21/h6,14-15,17,19H,5,7-13H2,1-4H3,(H,22,23)/t14-,15+,17+,19-,20-,21+/m0/s1 |
| InChIKey | LRWCMEOTIOLGOG-IZSOANEVSA-N |
| XLogP | 4.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|