C22H32O5 — CID 14164287
[3-oxo-8-(1,2,5,5-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-2-yl)-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate (PubChem CID 14164287) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [3-oxo-8-(1,2,5,5-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-2-yl)-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate.
| Compound Name | [3-oxo-8-(1,2,5,5-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-2-yl)-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate |
|---|---|
| PubChem CID | 14164287 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [3-oxo-8-(1,2,5,5-tetramethyl-1,3,4,6,7,8-hexahydronaphthalen-2-yl)-2,7-dioxabicyclo[3.2.1]octan-6-yl] acetate |
| SMILES | CC(=O)OC1OC2OC(=O)CC1C2C1(C)CCC2=C(CCCC2(C)C)C1C |
| InChI | InChI=1S/C22H32O5/c1-12-14-7-6-9-21(3,4)16(14)8-10-22(12,5)18-15-11-17(24)26-20(18)27-19(15)25-13(2)23/h12,15,18-20H,6-11H2,1-5H3 |
| InChIKey | QFAJOILVRWFPQA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|