C16H28O5Si — CID 101386413
(1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 101386413) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 101386413 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | C=C[C@H]1O[C@](C)(OC)[C@@](C)(OC)O[C@@H]1[C@@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H28O5Si/c1-9-13-14(12(17)10-11-22(6,7)8)21-16(3,19-5)15(2,18-4)20-13/h9,12-14,17H,1H2,2-8H3/t12-,13+,14+,15-,16-/m0/s1 |
| InChIKey | JXHWYZKFNLIFGO-OTJKEOIZSA-N |
| XLogP | 1.92 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|