C38H32N4O4 — CID 101386563
6-octyl-13-[4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 101386563) has the molecular formula C38H32N4O4 and a molecular weight of 608.70 g/mol. Its IUPAC name is 6-octyl-13-[4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-octyl-13-[4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 101386563 |
| Molecular Formula | C38H32N4O4 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 6-octyl-13-[4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCCCCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(c1ccc(-c2ccnc(-c4ccccn4)c2)cc1)C3=O |
| InChI | InChI=1S/C38H32N4O4/c1-2-3-4-5-6-9-22-41-35(43)27-15-17-29-34-30(18-16-28(33(27)34)36(41)44)38(46)42(37(29)45)26-13-11-24(12-14-26)25-19-21-40-32(23-25)31-10-7-8-20-39-31/h7-8,10-21,23H,2-6,9,22H2,1H3 |
| InChIKey | RVXYCRLISGJWOB-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|