C10H16O — CID 101386814
(3S,4Z)-3-[(E)-but-1-enyl]-4-ethylideneoxolane (PubChem CID 101386814) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (3S,4Z)-3-[(E)-but-1-enyl]-4-ethylideneoxolane.
| Compound Name | (3S,4Z)-3-[(E)-but-1-enyl]-4-ethylideneoxolane |
|---|---|
| PubChem CID | 101386814 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (3S,4Z)-3-[(E)-but-1-enyl]-4-ethylideneoxolane |
| SMILES | C/C=C1\COC[C@H]1/C=C/CC |
| InChI | InChI=1S/C10H16O/c1-3-5-6-10-8-11-7-9(10)4-2/h4-6,10H,3,7-8H2,1-2H3/b6-5+,9-4+/t10-/m1/s1 |
| InChIKey | SLSNLZBBFFXGBN-XOTQETGJSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|